C28H29N5O6 — CID 139922933
[3-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-2-(benzoyloxymethyl)cyclobutyl]methyl benzoate (PubChem CID 139922933) has the molecular formula C28H29N5O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is [3-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-2-(benzoyloxymethyl)cyclobutyl]methyl benzoate.
| Compound Name | [3-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-2-(benzoyloxymethyl)cyclobutyl]methyl benzoate |
|---|---|
| PubChem CID | 139922933 |
| Molecular Formula | C28H29N5O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | [3-[2-amino-6-(2-methoxyethoxy)purin-9-yl]-2-(benzoyloxymethyl)cyclobutyl]methyl benzoate |
| SMILES | COCCOc1nc(N)nc2c1ncn2C1CC(COC(=O)c2ccccc2)C1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29N5O6/c1-36-12-13-37-25-23-24(31-28(29)32-25)33(17-30-23)22-14-20(15-38-26(34)18-8-4-2-5-9-18)21(22)16-39-27(35)19-10-6-3-7-11-19/h2-11,17,20-22H,12-16H2,1H3,(H2,29,31,32) |
| InChIKey | SEHXQPKCBOMYOI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|