C20H22ClN5O2 — CID 54004815
[2-[(2-amino-6-chloropurin-9-yl)methyl]cyclohexyl]methyl benzoate (PubChem CID 54004815) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is [2-[(2-amino-6-chloropurin-9-yl)methyl]cyclohexyl]methyl benzoate.
| Compound Name | [2-[(2-amino-6-chloropurin-9-yl)methyl]cyclohexyl]methyl benzoate |
|---|---|
| PubChem CID | 54004815 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [2-[(2-amino-6-chloropurin-9-yl)methyl]cyclohexyl]methyl benzoate |
| SMILES | Nc1nc(Cl)c2ncn(CC3CCCCC3COC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H22ClN5O2/c21-17-16-18(25-20(22)24-17)26(12-23-16)10-14-8-4-5-9-15(14)11-28-19(27)13-6-2-1-3-7-13/h1-3,6-7,12,14-15H,4-5,8-11H2,(H2,22,24,25) |
| InChIKey | KOCPMWMBXDENSE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |