C31H26ClN5O7 — CID 90213158
[(2R,3R)-2-[(2-amino-6-chloropurin-9-yl)methoxy]-3,4-dibenzoyloxybutyl] benzoate (PubChem CID 90213158) has the molecular formula C31H26ClN5O7 and a molecular weight of 616.03 g/mol. Its IUPAC name is [(2R,3R)-2-[(2-amino-6-chloropurin-9-yl)methoxy]-3,4-dibenzoyloxybutyl] benzoate.
| Compound Name | [(2R,3R)-2-[(2-amino-6-chloropurin-9-yl)methoxy]-3,4-dibenzoyloxybutyl] benzoate |
|---|---|
| PubChem CID | 90213158 |
| Molecular Formula | C31H26ClN5O7 |
| Molecular Weight | 616.03 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | [(2R,3R)-2-[(2-amino-6-chloropurin-9-yl)methoxy]-3,4-dibenzoyloxybutyl] benzoate |
| SMILES | Nc1nc(Cl)c2ncn(CO[C@H](COC(=O)c3ccccc3)[C@@H](COC(=O)c3ccccc3)OC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C31H26ClN5O7/c32-26-25-27(36-31(33)35-26)37(18-34-25)19-43-23(16-41-28(38)20-10-4-1-5-11-20)24(44-30(40)22-14-8-3-9-15-22)17-42-29(39)21-12-6-2-7-13-21/h1-15,18,23-24H,16-17,19H2,(H2,33,35,36)/t23-,24-/m1/s1 |
| InChIKey | RCKHLLYJHUWNTR-DNQXCXABSA-N |
| XLogP | 4.34 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.03 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|