C17H20ClN5O2 — CID 54040507
(2R)-4-(2-amino-6-chloropurin-9-yl)-2-(phenylmethoxymethyl)butan-1-ol (PubChem CID 54040507) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is (2R)-4-(2-amino-6-chloropurin-9-yl)-2-(phenylmethoxymethyl)butan-1-ol.
| Compound Name | (2R)-4-(2-amino-6-chloropurin-9-yl)-2-(phenylmethoxymethyl)butan-1-ol |
|---|---|
| PubChem CID | 54040507 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2R)-4-(2-amino-6-chloropurin-9-yl)-2-(phenylmethoxymethyl)butan-1-ol |
| SMILES | Nc1nc(Cl)c2ncn(CC[C@H](CO)COCc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H20ClN5O2/c18-15-14-16(22-17(19)21-15)23(11-20-14)7-6-13(8-24)10-25-9-12-4-2-1-3-5-12/h1-5,11,13,24H,6-10H2,(H2,19,21,22)/t13-/m1/s1 |
| InChIKey | LLZDXDUKTPOXIF-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |