C14H18FN5O4 — CID 15162788
[2-(acetyloxymethyl)-4-(2-amino-6-fluoropurin-9-yl)butyl] acetate (PubChem CID 15162788) has the molecular formula C14H18FN5O4 and a molecular weight of 339.33 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-4-(2-amino-6-fluoropurin-9-yl)butyl] acetate.
| Compound Name | [2-(acetyloxymethyl)-4-(2-amino-6-fluoropurin-9-yl)butyl] acetate |
|---|---|
| PubChem CID | 15162788 |
| Molecular Formula | C14H18FN5O4 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [2-(acetyloxymethyl)-4-(2-amino-6-fluoropurin-9-yl)butyl] acetate |
| SMILES | CC(=O)OCC(CCn1cnc2c(F)nc(N)nc21)COC(C)=O |
| InChI | InChI=1S/C14H18FN5O4/c1-8(21)23-5-10(6-24-9(2)22)3-4-20-7-17-11-12(15)18-14(16)19-13(11)20/h7,10H,3-6H2,1-2H3,(H2,16,18,19) |
| InChIKey | PZYJQTKZGFLHRN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |