C17H28N6O4 — CID 164881903
[4-(2-amino-6-ethoxypurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate (PubChem CID 164881903) has the molecular formula C17H28N6O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-(2-amino-6-ethoxypurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate.
| Compound Name | [4-(2-amino-6-ethoxypurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 164881903 |
| Molecular Formula | C17H28N6O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [4-(2-amino-6-ethoxypurin-9-yl)-2-methoxybutyl] 2-amino-3-methylbutanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2CCC(COC(=O)C(N)C(C)C)OC |
| InChI | InChI=1S/C17H28N6O4/c1-5-26-15-13-14(21-17(19)22-15)23(9-20-13)7-6-11(25-4)8-27-16(24)12(18)10(2)3/h9-12H,5-8,18H2,1-4H3,(H2,19,21,22) |
| InChIKey | BUUZXKUQMMLIPJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |