C19H35N5O7P2 — CID 10051951
9-[4-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]butyl]-6-(2-methoxyethoxy)purin-2-amine (PubChem CID 10051951) has the molecular formula C19H35N5O7P2 and a molecular weight of 507.47 g/mol. Its IUPAC name is 9-[4-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]butyl]-6-(2-methoxyethoxy)purin-2-amine.
| Compound Name | 9-[4-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]butyl]-6-(2-methoxyethoxy)purin-2-amine |
|---|---|
| PubChem CID | 10051951 |
| Molecular Formula | C19H35N5O7P2 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 9-[4-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]butyl]-6-(2-methoxyethoxy)purin-2-amine |
| SMILES | CCOP(=O)(CCCCn1cnc2c(OCCOC)nc(N)nc21)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C19H35N5O7P2/c1-5-29-32(25,15-33(26,30-6-2)31-7-3)13-9-8-10-24-14-21-16-17(24)22-19(20)23-18(16)28-12-11-27-4/h14H,5-13,15H2,1-4H3,(H2,20,22,23) |
| InChIKey | SWOKJPJCSTXSBS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|