C20H34N5O5PSi — CID 91233048
9-[(4-diethoxyphosphoryl-2-methylidenebut-3-enoxy)methyl]-6-(2-trimethylsilylethoxy)purin-2-amine (PubChem CID 91233048) has the molecular formula C20H34N5O5PSi and a molecular weight of 483.58 g/mol. Its IUPAC name is 9-[(4-diethoxyphosphoryl-2-methylidenebut-3-enoxy)methyl]-6-(2-trimethylsilylethoxy)purin-2-amine.
| Compound Name | 9-[(4-diethoxyphosphoryl-2-methylidenebut-3-enoxy)methyl]-6-(2-trimethylsilylethoxy)purin-2-amine |
|---|---|
| PubChem CID | 91233048 |
| Molecular Formula | C20H34N5O5PSi |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 9-[(4-diethoxyphosphoryl-2-methylidenebut-3-enoxy)methyl]-6-(2-trimethylsilylethoxy)purin-2-amine |
| SMILES | C=C(C=CP(=O)(OCC)OCC)COCn1cnc2c(OCC[Si](C)(C)C)nc(N)nc21 |
| InChI | InChI=1S/C20H34N5O5PSi/c1-7-29-31(26,30-8-2)11-9-16(3)13-27-15-25-14-22-17-18(25)23-20(21)24-19(17)28-10-12-32(4,5)6/h9,11,14H,3,7-8,10,12-13,15H2,1-2,4-6H3,(H2,21,23,24) |
| InChIKey | UADSWFFLGDQIGA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|