C17H28N5O7P — CID 70986314
[2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-methylphosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 70986314) has the molecular formula C17H28N5O7P and a molecular weight of 445.41 g/mol. Its IUPAC name is [2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-methylphosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-methylphosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 70986314 |
| Molecular Formula | C17H28N5O7P |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [2-(2-amino-6-propoxypurin-9-yl)ethoxymethyl-methylphosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CCCOc1nc(N)nc2c1ncn2CCOCP(C)(=O)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C17H28N5O7P/c1-5-7-26-15-13-14(20-16(18)21-15)22(9-19-13)6-8-25-11-30(4,24)28-10-27-17(23)29-12(2)3/h9,12H,5-8,10-11H2,1-4H3,(H2,18,20,21) |
| InChIKey | YMVMSMOFCQFWKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|