C33H42N10O9P2 — CID 160868861
2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-methylphosphinic acid;9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]-6-methoxypurin-2-amine (PubChem CID 160868861) has the molecular formula C33H42N10O9P2 and a molecular weight of 784.71 g/mol. Its IUPAC name is 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-methylphosphinic acid;9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]-6-methoxypurin-2-amine.
| Compound Name | 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-methylphosphinic acid;9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 160868861 |
| Molecular Formula | C33H42N10O9P2 |
| Molecular Weight | 784.71 g/mol |
| Exact Mass | 784.26 |
| IUPAC Name | 2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-methylphosphinic acid;9-[2-[bis(phenylmethoxy)phosphorylmethoxy]ethyl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2CCOCP(=O)(OCc1ccccc1)OCc1ccccc1.COc1nc(N)nc2c1ncn2CCOCP(C)(=O)O |
| InChI | InChI=1S/C23H26N5O5P.C10H16N5O4P/c1-30-22-20-21(26-23(24)27-22)28(16-25-20)12-13-31-17-34(29,32-14-18-8-4-2-5-9-18)33-15-19-10-6-3-7-11-19;1-18-9-7-8(13-10(11)14-9)15(5-12-7)3-4-19-6-20(2,16)17/h2-11,16H,12-15,17H2,1H3,(H2,24,26,27);5H,3-4,6H2,1-2H3,(H,16,17)(H2,11,13,14) |
| InChIKey | SLMOHLZHXXSTLW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 248.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|