C16H20N5O3P — CID 177172491
6-methoxy-9-[2-(phenylmethoxyphosphanylmethoxy)ethyl]purin-2-amine (PubChem CID 177172491) has the molecular formula C16H20N5O3P and a molecular weight of 361.34 g/mol. Its IUPAC name is 6-methoxy-9-[2-(phenylmethoxyphosphanylmethoxy)ethyl]purin-2-amine.
| Compound Name | 6-methoxy-9-[2-(phenylmethoxyphosphanylmethoxy)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 177172491 |
| Molecular Formula | C16H20N5O3P |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 6-methoxy-9-[2-(phenylmethoxyphosphanylmethoxy)ethyl]purin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2CCOCPOCc1ccccc1 |
| InChI | InChI=1S/C16H20N5O3P/c1-22-15-13-14(19-16(17)20-15)21(10-18-13)7-8-23-11-25-24-9-12-5-3-2-4-6-12/h2-6,10,25H,7-9,11H2,1H3,(H2,17,19,20) |
| InChIKey | CWKPMZHEXXBMNO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|