C9H14N5O2P — CID 143852222
9-[2-(methoxyphosphanylmethoxy)ethyl]purin-2-amine (PubChem CID 143852222) has the molecular formula C9H14N5O2P and a molecular weight of 255.22 g/mol. Its IUPAC name is 9-[2-(methoxyphosphanylmethoxy)ethyl]purin-2-amine.
| Compound Name | 9-[2-(methoxyphosphanylmethoxy)ethyl]purin-2-amine |
|---|---|
| PubChem CID | 143852222 |
| Molecular Formula | C9H14N5O2P |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 9-[2-(methoxyphosphanylmethoxy)ethyl]purin-2-amine |
| SMILES | COPCOCCn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C9H14N5O2P/c1-15-17-6-16-3-2-14-5-12-7-4-11-9(10)13-8(7)14/h4-5,17H,2-3,6H2,1H3,(H2,10,11,13) |
| InChIKey | IMRIJKIUAFUUSA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|