C10H16N5O6P — CID 67947814
[4-(2-aminopurin-9-yl)-1-hydroxy-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 67947814) has the molecular formula C10H16N5O6P and a molecular weight of 333.24 g/mol. Its IUPAC name is [4-(2-aminopurin-9-yl)-1-hydroxy-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [4-(2-aminopurin-9-yl)-1-hydroxy-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67947814 |
| Molecular Formula | C10H16N5O6P |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [4-(2-aminopurin-9-yl)-1-hydroxy-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | Nc1ncc2ncn(CCC(CO)C(O)OP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H16N5O6P/c11-10-12-3-7-8(14-10)15(5-13-7)2-1-6(4-16)9(17)21-22(18,19)20/h3,5-6,9,16-17H,1-2,4H2,(H2,11,12,14)(H2,18,19,20) |
| InChIKey | HWVODJUPEBWIPR-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|