C9H15N5O — CID 142975458
2-(2-aminopurin-9-yl)ethanol;ethane (PubChem CID 142975458) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(2-aminopurin-9-yl)ethanol;ethane.
| Compound Name | 2-(2-aminopurin-9-yl)ethanol;ethane |
|---|---|
| PubChem CID | 142975458 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-(2-aminopurin-9-yl)ethanol;ethane |
| SMILES | CC.Nc1ncc2ncn(CCO)c2n1 |
| InChI | InChI=1S/C7H9N5O.C2H6/c8-7-9-3-5-6(11-7)12(1-2-13)4-10-5;1-2/h3-4,13H,1-2H2,(H2,8,9,11);1-2H3 |
| InChIKey | HVWUWJGKUWWPOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |