C12H15N5O4 — CID 169440387
methyl 2-(acetyloxymethyl)-3-(2-aminopurin-9-yl)propanoate (PubChem CID 169440387) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is methyl 2-(acetyloxymethyl)-3-(2-aminopurin-9-yl)propanoate.
| Compound Name | methyl 2-(acetyloxymethyl)-3-(2-aminopurin-9-yl)propanoate |
|---|---|
| PubChem CID | 169440387 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | methyl 2-(acetyloxymethyl)-3-(2-aminopurin-9-yl)propanoate |
| SMILES | COC(=O)C(COC(C)=O)Cn1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C12H15N5O4/c1-7(18)21-5-8(11(19)20-2)4-17-6-15-9-3-14-12(13)16-10(9)17/h3,6,8H,4-5H2,1-2H3,(H2,13,14,16) |
| InChIKey | AQZRGZBMDRQQQY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |