C10H13N5O2 — CID 57158718
[2-(2-aminopurin-9-yl)-3-(hydroxymethyl)cyclopropyl]methanol (PubChem CID 57158718) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is [2-(2-aminopurin-9-yl)-3-(hydroxymethyl)cyclopropyl]methanol.
| Compound Name | [2-(2-aminopurin-9-yl)-3-(hydroxymethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 57158718 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [2-(2-aminopurin-9-yl)-3-(hydroxymethyl)cyclopropyl]methanol |
| SMILES | Nc1ncc2ncn(C3C(CO)C3CO)c2n1 |
| InChI | InChI=1S/C10H13N5O2/c11-10-12-1-7-9(14-10)15(4-13-7)8-5(2-16)6(8)3-17/h1,4-6,8,16-17H,2-3H2,(H2,11,12,14) |
| InChIKey | JPXVWDFNMQBUOF-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |