C17H19FN5O5P — CID 19018885
[3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (4-fluorophenyl) hydrogen phosphate (PubChem CID 19018885) has the molecular formula C17H19FN5O5P and a molecular weight of 423.34 g/mol. Its IUPAC name is [3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (4-fluorophenyl) hydrogen phosphate.
| Compound Name | [3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (4-fluorophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 19018885 |
| Molecular Formula | C17H19FN5O5P |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [3-(2-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]methyl (4-fluorophenyl) hydrogen phosphate |
| SMILES | Nc1ncc2ncn(C3CC(COP(=O)(O)Oc4ccc(F)cc4)C3CO)c2n1 |
| InChI | InChI=1S/C17H19FN5O5P/c18-11-1-3-12(4-2-11)28-29(25,26)27-8-10-5-15(13(10)7-24)23-9-21-14-6-20-17(19)22-16(14)23/h1-4,6,9-10,13,15,24H,5,7-8H2,(H,25,26)(H2,19,20,22) |
| InChIKey | VDAUOAQPYNTMLS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|