C11H24N5O15P3 — CID 173009169
2-amino-9-[(1S,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;phosphoric acid (PubChem CID 173009169) has the molecular formula C11H24N5O15P3 and a molecular weight of 559.26 g/mol. Its IUPAC name is 2-amino-9-[(1S,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;phosphoric acid.
| Compound Name | 2-amino-9-[(1S,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;phosphoric acid |
|---|---|
| PubChem CID | 173009169 |
| Molecular Formula | C11H24N5O15P3 |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | 2-amino-9-[(1S,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one;phosphoric acid |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](CO)[C@H]2CO)c(=O)[nH]1.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C11H15N5O3.3H3O4P/c12-11-14-9-8(10(19)15-11)13-4-16(9)7-1-5(2-17)6(7)3-18;3*1-5(2,3)4/h4-7,17-18H,1-3H2,(H3,12,14,15,19);3*(H3,1,2,3,4)/t5-,6-,7+;;;/m1.../s1 |
| InChIKey | VSNJPCZVLGXINW-YNDMERRNSA-N |
| XLogP | -3.92 |
| TPSA | 363.33 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|