C13H17N5O3 — CID 136675494
2-amino-9-[(1R,4S,5R)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]-1H-purin-6-one (PubChem CID 136675494) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-9-[(1R,4S,5R)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,4S,5R)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136675494 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-amino-9-[(1R,4S,5R)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C=C[C@H](CO)[C@H](CO)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N5O3/c14-13-16-11-10(12(21)17-13)15-6-18(11)9-2-1-7(4-19)8(3-9)5-20/h1-2,6-9,19-20H,3-5H2,(H3,14,16,17,21)/t7-,8+,9+/m1/s1 |
| InChIKey | VXHAFMSUUADNKB-VGMNWLOBSA-N |
| XLogP | -0.58 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|