C12H16N5O6P — CID 137350162
[(1R,4S,6S)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-hydroxycyclohex-2-en-1-yl]methyl dihydrogen phosphate (PubChem CID 137350162) has the molecular formula C12H16N5O6P and a molecular weight of 357.26 g/mol. Its IUPAC name is [(1R,4S,6S)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-hydroxycyclohex-2-en-1-yl]methyl dihydrogen phosphate.
| Compound Name | [(1R,4S,6S)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-hydroxycyclohex-2-en-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137350162 |
| Molecular Formula | C12H16N5O6P |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [(1R,4S,6S)-4-(2-amino-6-oxo-1H-purin-9-yl)-6-hydroxycyclohex-2-en-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2C=C[C@H](COP(=O)(O)O)[C@@H](O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H16N5O6P/c13-12-15-10-9(11(19)16-12)14-5-17(10)7-2-1-6(8(18)3-7)4-23-24(20,21)22/h1-2,5-8,18H,3-4H2,(H2,20,21,22)(H3,13,15,16,19)/t6-,7-,8+/m1/s1 |
| InChIKey | FOPKVDVUUHAUSX-PRJMDXOYSA-N |
| XLogP | -0.71 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|