C11H12N5O8P2-3 — CID 162422374
[[(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-oxidophosphoryl] phosphate (PubChem CID 162422374) has the molecular formula C11H12N5O8P2-3 and a molecular weight of 404.19 g/mol. Its IUPAC name is [[(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-oxidophosphoryl] phosphate.
| Compound Name | [[(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 162422374 |
| Molecular Formula | C11H12N5O8P2-3 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | [[(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-oxidophosphoryl] phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2C=C[C@@H](COP(=O)([O-])OP(=O)([O-])[O-])C2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O8P2/c12-11-14-9-8(10(17)15-11)13-5-16(9)7-2-1-6(3-7)4-23-26(21,22)24-25(18,19)20/h1-2,5-7H,3-4H2,(H,21,22)(H2,18,19,20)(H3,12,14,15,17)/p-3/t6-,7+/m1/s1 |
| InChIKey | LBDJPXUIKREEKI-RQJHMYQMSA-K |
| XLogP | -1.85 |
| TPSA | 211.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|