C12H18N5O10P3 — CID 135423978
[[[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 135423978) has the molecular formula C12H18N5O10P3 and a molecular weight of 485.22 g/mol. Its IUPAC name is [[[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 135423978 |
| Molecular Formula | C12H18N5O10P3 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | [[[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]oxymethyl-hydroxyphosphoryl]oxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Nc1nc2c(ncn2[C@@H]2C=C[C@H](OCP(=O)(O)OP(=O)(O)CP(=O)(O)O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H18N5O10P3/c13-12-15-10-9(11(18)16-12)14-4-17(10)7-1-2-8(3-7)26-5-29(22,23)27-30(24,25)6-28(19,20)21/h1-2,4,7-8H,3,5-6H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,13,15,16,18)/t7-,8+/m1/s1 |
| InChIKey | HDFZEJGDHIYEFI-SFYZADRCSA-N |
| XLogP | 0.07 |
| TPSA | 240.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|