C11H15N5O5P- — CID 147993990
[(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)cyclopentyl]methyl hydrogen phosphate (PubChem CID 147993990) has the molecular formula C11H15N5O5P- and a molecular weight of 328.25 g/mol. Its IUPAC name is [(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)cyclopentyl]methyl hydrogen phosphate.
| Compound Name | [(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)cyclopentyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 147993990 |
| Molecular Formula | C11H15N5O5P- |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | [(1R,3S)-3-(2-amino-6-oxo-1H-purin-9-yl)cyclopentyl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2CC[C@@H](COP(=O)([O-])O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H16N5O5P/c12-11-14-9-8(10(17)15-11)13-5-16(9)7-2-1-6(3-7)4-21-22(18,19)20/h5-7H,1-4H2,(H2,18,19,20)(H3,12,14,15,17)/p-1/t6-,7+/m1/s1 |
| InChIKey | IVQIICFXEAVHAE-RQJHMYQMSA-M |
| XLogP | -0.48 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|