C15H21N5O2 — CID 135547095
2-amino-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]-1H-purin-6-one (PubChem CID 135547095) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-amino-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135547095 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-amino-9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)OC[C@H]1C=C[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)22-7-9-4-5-10(6-9)20-8-17-11-12(20)18-14(16)19-13(11)21/h4-5,8-10H,6-7H2,1-3H3,(H3,16,18,19,21)/t9-,10+/m0/s1 |
| InChIKey | RROJQRPDJUSVJY-VHSXEESVSA-N |
| XLogP | 1.63 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|