C11H14N5O6P — CID 135511261
[(3R,6S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3,6-dihydro-2H-pyran-6-yl]oxymethylphosphonic acid (PubChem CID 135511261) has the molecular formula C11H14N5O6P and a molecular weight of 343.24 g/mol. Its IUPAC name is [(3R,6S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3,6-dihydro-2H-pyran-6-yl]oxymethylphosphonic acid.
| Compound Name | [(3R,6S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3,6-dihydro-2H-pyran-6-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 135511261 |
| Molecular Formula | C11H14N5O6P |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [(3R,6S)-3-(2-amino-6-oxo-1H-purin-9-yl)-3,6-dihydro-2H-pyran-6-yl]oxymethylphosphonic acid |
| SMILES | Nc1nc2c(ncn2[C@@H]2C=C[C@H](OCP(=O)(O)O)OC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N5O6P/c12-11-14-9-8(10(17)15-11)13-4-16(9)6-1-2-7(21-3-6)22-5-23(18,19)20/h1-2,4,6-7H,3,5H2,(H2,18,19,20)(H3,12,14,15,17)/t6-,7+/m1/s1 |
| InChIKey | JYQCIFLHFBRICO-RQJHMYQMSA-N |
| XLogP | -0.69 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|