C9H11N5O6P+ — CID 165156006
[(2R,3S)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 165156006) has the molecular formula C9H11N5O6P+ and a molecular weight of 316.19 g/mol. Its IUPAC name is [(2R,3S)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 165156006 |
| Molecular Formula | C9H11N5O6P+ |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [(2R,3S)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | Nc1nc2c(ncn2[C@@H]2OCC(O)[C@@H]2O[P+](=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H10N5O6P/c10-9-12-6-4(7(16)13-9)11-2-14(6)8-5(20-21(17)18)3(15)1-19-8/h2-3,5,8,15H,1H2,(H3-,10,12,13,16,17,18)/p+1/t3?,5-,8+/m0/s1 |
| InChIKey | PPPUREQLALPFFR-HWYOQWQTSA-O |
| XLogP | -1.37 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|