C22H40N6O7P+ — CID 137169167
[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(propan-2-yloxy)oxolan-2-yl]methoxy-hydroxy-oxophosphanium;N,N-diethylethanamine (PubChem CID 137169167) has the molecular formula C22H40N6O7P+ and a molecular weight of 531.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(propan-2-yloxy)oxolan-2-yl]methoxy-hydroxy-oxophosphanium;N,N-diethylethanamine.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(propan-2-yloxy)oxolan-2-yl]methoxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
|---|---|
| PubChem CID | 137169167 |
| Molecular Formula | C22H40N6O7P+ |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(propan-2-yloxy)oxolan-2-yl]methoxy-hydroxy-oxophosphanium;N,N-diethylethanamine |
| SMILES | CC(C)O[C@@H]1[C@H](OC(C)C)[C@@H](CO[P+](=O)O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21.CCN(CC)CC |
| InChI | InChI=1S/C16H24N5O7P.C6H15N/c1-7(2)26-11-9(5-25-29(23)24)28-15(12(11)27-8(3)4)21-6-18-10-13(21)19-16(17)20-14(10)22;1-4-7(5-2)6-3/h6-9,11-12,15H,5H2,1-4H3,(H3-,17,19,20,22,23,24);4-6H2,1-3H3/p+1/t9-,11-,12-,15-;/m1./s1 |
| InChIKey | NZSVCVQUSIQTDO-DNBRLMRSSA-O |
| XLogP | 2.20 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|