C17H26N6O6S — CID 168757067
2-amino-9-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 168757067) has the molecular formula C17H26N6O6S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 168757067 |
| Molecular Formula | C17H26N6O6S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | CO[C@@H]1[C@H](OC(C)C)[C@@H](CN2CCCS2(=O)=O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C17H26N6O6S/c1-9(2)28-12-10(7-22-5-4-6-30(22,25)26)29-16(13(12)27-3)23-8-19-11-14(23)20-17(18)21-15(11)24/h8-10,12-13,16H,4-7H2,1-3H3,(H3,18,20,21,24)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | RRPZEXUNDKFMDY-XNIJJKJLSA-N |
| XLogP | -0.56 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |