C17H27N3O7S — CID 168757121
1-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 168757121) has the molecular formula C17H27N3O7S and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 168757121 |
| Molecular Formula | C17H27N3O7S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-3-methoxy-4-propan-2-yloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CO[C@@H]1[C@H](OC(C)C)[C@@H](CN2CCCS2(=O)=O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H27N3O7S/c1-10(2)26-13-12(9-19-6-5-7-28(19,23)24)27-16(14(13)25-4)20-8-11(3)15(21)18-17(20)22/h8,10,12-14,16H,5-7,9H2,1-4H3,(H,18,21,22)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | YBCKKUVQZBATGA-IXYNUQLISA-N |
| XLogP | -0.41 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |