C12H20N2O11P2 — CID 155537750
[hydroxy-[[(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid (PubChem CID 155537750) has the molecular formula C12H20N2O11P2 and a molecular weight of 430.24 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid.
| Compound Name | [hydroxy-[[(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155537750 |
| Molecular Formula | C12H20N2O11P2 |
| Molecular Weight | 430.24 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | [hydroxy-[[(2R,3R,4R,5R)-3-hydroxy-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]methylphosphonic acid |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](COP(=O)(O)CP(=O)(O)O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H20N2O11P2/c1-6-3-14(12(17)13-10(6)16)11-9(23-2)8(15)7(25-11)4-24-27(21,22)5-26(18,19)20/h3,7-9,11,15H,4-5H2,1-2H3,(H,21,22)(H,13,16,17)(H2,18,19,20)/t7-,8-,9-,11-/m1/s1 |
| InChIKey | AYLRDCMVLGWCIO-TURQNECASA-N |
| XLogP | -1.54 |
| TPSA | 197.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.24 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|