C10H12ClN5O3 — CID 136980531
2-amino-9-[(2R,3R,4R)-3-chloro-4-hydroxy-3-methyloxolan-2-yl]-1H-purin-6-one (PubChem CID 136980531) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R)-3-chloro-4-hydroxy-3-methyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R)-3-chloro-4-hydroxy-3-methyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136980531 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R)-3-chloro-4-hydroxy-3-methyloxolan-2-yl]-1H-purin-6-one |
| SMILES | C[C@@]1(Cl)[C@H](O)CO[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H12ClN5O3/c1-10(11)4(17)2-19-8(10)16-3-13-5-6(16)14-9(12)15-7(5)18/h3-4,8,17H,2H2,1H3,(H3,12,14,15,18)/t4-,8-,10-/m1/s1 |
| InChIKey | GIBWPFJUXNGMLX-OANIWSLYSA-N |
| XLogP | -0.41 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|