C13H13Cl2N5O4 — CID 145393294
2-amino-9-[(4S)-3-chloro-3-(2-chloroethynyl)-4-hydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 145393294) has the molecular formula C13H13Cl2N5O4 and a molecular weight of 374.18 g/mol. Its IUPAC name is 2-amino-9-[(4S)-3-chloro-3-(2-chloroethynyl)-4-hydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(4S)-3-chloro-3-(2-chloroethynyl)-4-hydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145393294 |
| Molecular Formula | C13H13Cl2N5O4 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-amino-9-[(4S)-3-chloro-3-(2-chloroethynyl)-4-hydroxy-5-(1-hydroxyethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(O)C1OC(n2cnc3c(=O)[nH]c(N)nc32)C(Cl)(C#CCl)[C@H]1O |
| InChI | InChI=1S/C13H13Cl2N5O4/c1-5(21)7-8(22)13(15,2-3-14)11(24-7)20-4-17-6-9(20)18-12(16)19-10(6)23/h4-5,7-8,11,21-22H,1H3,(H3,16,18,19,23)/t5?,7?,8-,11?,13?/m0/s1 |
| InChIKey | LQBNRKBWRGGPCO-RQPVUSQZSA-N |
| XLogP | -0.48 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|