C16H18ClFN4O4 — CID 153188864
2-amino-7-[(2R,5S)-3-chloro-5-[(1S)-1-hydroxyethyl]-4-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 153188864) has the molecular formula C16H18ClFN4O4 and a molecular weight of 384.80 g/mol. Its IUPAC name is 2-amino-7-[(2R,5S)-3-chloro-5-[(1S)-1-hydroxyethyl]-4-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(2R,5S)-3-chloro-5-[(1S)-1-hydroxyethyl]-4-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 153188864 |
| Molecular Formula | C16H18ClFN4O4 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-amino-7-[(2R,5S)-3-chloro-5-[(1S)-1-hydroxyethyl]-4-(hydroxymethyl)-3-prop-1-ynyloxolan-2-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CC#CC1(Cl)C(CO)[C@@H]([C@H](C)O)O[C@H]1n1cc(F)c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C16H18ClFN4O4/c1-3-4-16(17)8(6-23)11(7(2)24)26-14(16)22-5-9(18)10-12(22)20-15(19)21-13(10)25/h5,7-8,11,14,23-24H,6H2,1-2H3,(H3,19,20,21,25)/t7-,8?,11+,14+,16?/m0/s1 |
| InChIKey | WHPVIGFDDLIISG-LLJBWVLPSA-N |
| XLogP | 0.33 |
| TPSA | 126.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|