About 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol
2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol (PubChem CID 164882319) has the molecular formula C13H21FN4O5
and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol.
Molecular Properties
| Compound Name | 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol |
| PubChem CID | 164882319 |
| Molecular Formula | C13H21FN4O5 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol |
| SMILES | CO.CO.Nc1nc2c(c(F)cn2C2CCC(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13FN4O3.2CH4O/c12-6-3-16(7-2-1-5(4-17)19-7)9-8(6)10(18)15-11(13)14-9;2*1-2/h3,5,7,17H,1-2,4H2,(H3,13,14,15,18);2*2H,1H3 |
| InChIKey | VGOFHLIFPWMTTC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol?
The IUPAC name of 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol (CID 164882319) is 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol.
What is the SMILES notation for 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol?
The canonical SMILES for 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol is CO.CO.Nc1nc2c(c(F)cn2C2CCC(CO)O2)c(=O)[nH]1.
What is the InChIKey of 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol?
The InChIKey is VGOFHLIFPWMTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN4O3.2CH4O/c12-6-3-16(7-2-1-5(4-17)19-7)9-8(6)10(18)15-11(13)14-9;2*1-2/h3,5,7,17H,1-2,4H2,(H3,13,14,15,18);2*2H,1H3.
What are the key properties of 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol?
2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol has a molecular weight of 332.33 g/mol, XLogP of -0.67, 2 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-fluoro-7-[5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;methanol is sourced from PubChem (CID 164882319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).