C14H18FN5O4 — CID 145393110
2-amino-7-[(4S)-4-amino-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 145393110) has the molecular formula C14H18FN5O4 and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-amino-7-[(4S)-4-amino-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(4S)-4-amino-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145393110 |
| Molecular Formula | C14H18FN5O4 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-amino-7-[(4S)-4-amino-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoro-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CC#C[C@@](N)(C(O)C(CO)OC)n1cc(F)c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H18FN5O4/c1-3-4-14(17,10(22)8(6-21)24-2)20-5-7(15)9-11(20)18-13(16)19-12(9)23/h5,8,10,21-22H,6,17H2,1-2H3,(H3,16,18,19,23)/t8?,10?,14-/m0/s1 |
| InChIKey | YAFZNLQECREZTI-KJSXGGJUSA-N |
| XLogP | -1.55 |
| TPSA | 152.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|