C9H13FN2O6 — CID 156523096
5-fluoro-1-[(1R,2R,3R)-1,2,4-trihydroxy-3-methoxybutyl]pyrimidine-2,4-dione (PubChem CID 156523096) has the molecular formula C9H13FN2O6 and a molecular weight of 264.21 g/mol. Its IUPAC name is 5-fluoro-1-[(1R,2R,3R)-1,2,4-trihydroxy-3-methoxybutyl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(1R,2R,3R)-1,2,4-trihydroxy-3-methoxybutyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156523096 |
| Molecular Formula | C9H13FN2O6 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 5-fluoro-1-[(1R,2R,3R)-1,2,4-trihydroxy-3-methoxybutyl]pyrimidine-2,4-dione |
| SMILES | CO[C@H](CO)[C@@H](O)[C@@H](O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13FN2O6/c1-18-5(3-13)6(14)8(16)12-2-4(10)7(15)11-9(12)17/h2,5-6,8,13-14,16H,3H2,1H3,(H,11,15,17)/t5-,6-,8-/m1/s1 |
| InChIKey | SYXPWUYBJMFTIE-ATRFCDNQSA-N |
| XLogP | -2.47 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |