C8H11FN2O5 — CID 70515654
1-(2,3-dihydroxy-3-methoxypropyl)-5-fluoropyrimidine-2,4-dione (PubChem CID 70515654) has the molecular formula C8H11FN2O5 and a molecular weight of 234.18 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-3-methoxypropyl)-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(2,3-dihydroxy-3-methoxypropyl)-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70515654 |
| Molecular Formula | C8H11FN2O5 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-(2,3-dihydroxy-3-methoxypropyl)-5-fluoropyrimidine-2,4-dione |
| SMILES | COC(O)C(O)Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11FN2O5/c1-16-7(14)5(12)3-11-2-4(9)6(13)10-8(11)15/h2,5,7,12,14H,3H2,1H3,(H,10,13,15) |
| InChIKey | CZXJONAXNFILEO-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|