C12H19FN2O3 — CID 11322863
5-fluoro-1-(2-hydroxyoctyl)pyrimidine-2,4-dione (PubChem CID 11322863) has the molecular formula C12H19FN2O3 and a molecular weight of 258.29 g/mol. Its IUPAC name is 5-fluoro-1-(2-hydroxyoctyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(2-hydroxyoctyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11322863 |
| Molecular Formula | C12H19FN2O3 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-fluoro-1-(2-hydroxyoctyl)pyrimidine-2,4-dione |
| SMILES | CCCCCCC(O)Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19FN2O3/c1-2-3-4-5-6-9(16)7-15-8-10(13)11(17)14-12(15)18/h8-9,16H,2-7H2,1H3,(H,14,17,18) |
| InChIKey | TVUDFNLYJIFYPY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|