C12H17FN2O4 — CID 13014276
(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl heptanoate (PubChem CID 13014276) has the molecular formula C12H17FN2O4 and a molecular weight of 272.28 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl heptanoate.
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl heptanoate |
|---|---|
| PubChem CID | 13014276 |
| Molecular Formula | C12H17FN2O4 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methyl heptanoate |
| SMILES | CCCCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17FN2O4/c1-2-3-4-5-6-10(16)19-8-15-7-9(13)11(17)14-12(15)18/h7H,2-6,8H2,1H3,(H,14,17,18) |
| InChIKey | PUILJWZPOGZPHF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|