C17H12F6N2O6 — CID 10623582
1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 6-O-(2,3,4,5,6-pentafluorophenyl) hexanedioate (PubChem CID 10623582) has the molecular formula C17H12F6N2O6 and a molecular weight of 454.28 g/mol. Its IUPAC name is 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 6-O-(2,3,4,5,6-pentafluorophenyl) hexanedioate.
| Compound Name | 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 6-O-(2,3,4,5,6-pentafluorophenyl) hexanedioate |
|---|---|
| PubChem CID | 10623582 |
| Molecular Formula | C17H12F6N2O6 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 6-O-(2,3,4,5,6-pentafluorophenyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H12F6N2O6/c18-7-5-25(17(29)24-16(7)28)6-30-8(26)3-1-2-4-9(27)31-15-13(22)11(20)10(19)12(21)14(15)23/h5H,1-4,6H2,(H,24,28,29) |
| InChIKey | LAXYELUBIVBINC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|