C15H8F6N2O6 — CID 10526436
1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate (PubChem CID 10526436) has the molecular formula C15H8F6N2O6 and a molecular weight of 426.23 g/mol. Its IUPAC name is 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate.
| Compound Name | 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate |
|---|---|
| PubChem CID | 10526436 |
| Molecular Formula | C15H8F6N2O6 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-O-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl] 4-O-(2,3,4,5,6-pentafluorophenyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H8F6N2O6/c16-5-3-23(15(27)22-14(5)26)4-28-6(24)1-2-7(25)29-13-11(20)9(18)8(17)10(19)12(13)21/h3H,1-2,4H2,(H,22,26,27) |
| InChIKey | YMLKHWOYYLZIPH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|