C6H7FN4O3 — CID 70581549
(5-fluoro-2,4-dioxopyrimidin-1-yl)methylurea (PubChem CID 70581549) has the molecular formula C6H7FN4O3 and a molecular weight of 202.15 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxopyrimidin-1-yl)methylurea.
| Compound Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methylurea |
|---|---|
| PubChem CID | 70581549 |
| Molecular Formula | C6H7FN4O3 |
| Molecular Weight | 202.15 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (5-fluoro-2,4-dioxopyrimidin-1-yl)methylurea |
| SMILES | NC(=O)NCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7FN4O3/c7-3-1-11(2-9-5(8)13)6(14)10-4(3)12/h1H,2H2,(H3,8,9,13)(H,10,12,14) |
| InChIKey | LFHQEHMNBCHVAD-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.15 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |