C12H11FN4O3 — CID 63579069
3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide (PubChem CID 63579069) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide.
| Compound Name | 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 63579069 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]benzohydrazide |
| SMILES | NNC(=O)c1cccc(Cn2cc(F)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C12H11FN4O3/c13-9-6-17(12(20)15-11(9)19)5-7-2-1-3-8(4-7)10(18)16-14/h1-4,6H,5,14H2,(H,16,18)(H,15,19,20) |
| InChIKey | HESLLWBIDMCUOR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|