C11H9AgFN2O2 — CID 88760858
1-benzyl-5-fluoropyrimidine-2,4-dione;silver (PubChem CID 88760858) has the molecular formula C11H9AgFN2O2 and a molecular weight of 328.07 g/mol. Its IUPAC name is 1-benzyl-5-fluoropyrimidine-2,4-dione;silver.
| Compound Name | 1-benzyl-5-fluoropyrimidine-2,4-dione;silver |
|---|---|
| PubChem CID | 88760858 |
| Molecular Formula | C11H9AgFN2O2 |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 1-benzyl-5-fluoropyrimidine-2,4-dione;silver |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)cc1F.[Ag] |
| InChI | InChI=1S/C11H9FN2O2.Ag/c12-9-7-14(11(16)13-10(9)15)6-8-4-2-1-3-5-8;/h1-5,7H,6H2,(H,13,15,16); |
| InChIKey | VPWOKSCVTQUTKE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |