C15H9FN2O4 — CID 51039962
1-[(1,4-dioxonaphthalen-2-yl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 51039962) has the molecular formula C15H9FN2O4 and a molecular weight of 300.25 g/mol. Its IUPAC name is 1-[(1,4-dioxonaphthalen-2-yl)methyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(1,4-dioxonaphthalen-2-yl)methyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51039962 |
| Molecular Formula | C15H9FN2O4 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-[(1,4-dioxonaphthalen-2-yl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=C1C=C(Cn2cc(F)c(=O)[nH]c2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H9FN2O4/c16-11-7-18(15(22)17-14(11)21)6-8-5-12(19)9-3-1-2-4-10(9)13(8)20/h1-5,7H,6H2,(H,17,21,22) |
| InChIKey | GVCMIKYOEKANSW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|