C32H24F2N6O8 — CID 139145273
2-[(Z)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)but-2-enyl]isoindole-1,3-dione (PubChem CID 139145273) has the molecular formula C32H24F2N6O8 and a molecular weight of 658.57 g/mol. Its IUPAC name is 2-[(Z)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)but-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)but-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139145273 |
| Molecular Formula | C32H24F2N6O8 |
| Molecular Weight | 658.57 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | 2-[(Z)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)but-2-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C/C=C\Cn1cc(F)c(=O)[nH]c1=O.O=C1c2ccccc2C(=O)N1C/C=C\Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/2C16H12FN3O4/c2*17-12-9-19(16(24)18-13(12)21)7-3-4-8-20-14(22)10-5-1-2-6-11(10)15(20)23/h2*1-6,9H,7-8H2,(H,18,21,24)/b2*4-3- |
| InChIKey | JGPHCOQBBQCNKQ-CHNJZELVSA-N |
| XLogP | 1.06 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.57 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|