About [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid
[(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid (PubChem CID 50993719) has the molecular formula C7H8FN2O5P
and a molecular weight of 250.12 g/mol. Its IUPAC name is [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid |
| PubChem CID | 50993719 |
| Molecular Formula | C7H8FN2O5P |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid |
| SMILES | O=c1[nH]c(=O)n(C/C=C/P(=O)(O)O)cc1F |
| InChI | InChI=1S/C7H8FN2O5P/c8-5-4-10(7(12)9-6(5)11)2-1-3-16(13,14)15/h1,3-4H,2H2,(H,9,11,12)(H2,13,14,15)/b3-1+ |
| InChIKey | CJBKJLYOEANVKE-HNQUOIGGSA-N |
| XLogP | -0.63 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid?
The IUPAC name of [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid (CID 50993719) is [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid.
What is the SMILES notation for [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid?
The canonical SMILES for [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid is O=c1[nH]c(=O)n(C/C=C/P(=O)(O)O)cc1F.
What is the InChIKey of [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid?
The InChIKey is CJBKJLYOEANVKE-HNQUOIGGSA-N. The full InChI is InChI=1S/C7H8FN2O5P/c8-5-4-10(7(12)9-6(5)11)2-1-3-16(13,14)15/h1,3-4H,2H2,(H,9,11,12)(H2,13,14,15)/b3-1+.
What are the key properties of [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid?
[(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid has a molecular weight of 250.12 g/mol, XLogP of -0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)prop-1-enyl]phosphonic acid is sourced from PubChem (CID 50993719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).