C11H9BrFN3O2 — CID 63557584
1-[(4-amino-2-bromophenyl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 63557584) has the molecular formula C11H9BrFN3O2 and a molecular weight of 314.11 g/mol. Its IUPAC name is 1-[(4-amino-2-bromophenyl)methyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4-amino-2-bromophenyl)methyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63557584 |
| Molecular Formula | C11H9BrFN3O2 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 1-[(4-amino-2-bromophenyl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | Nc1ccc(Cn2cc(F)c(=O)[nH]c2=O)c(Br)c1 |
| InChI | InChI=1S/C11H9BrFN3O2/c12-8-3-7(14)2-1-6(8)4-16-5-9(13)10(17)15-11(16)18/h1-3,5H,4,14H2,(H,15,17,18) |
| InChIKey | HMHPNUITDWBUMO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|