C11H7BrF2N2O2 — CID 63777458
5-bromo-1-[(2,4-difluorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 63777458) has the molecular formula C11H7BrF2N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is 5-bromo-1-[(2,4-difluorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2,4-difluorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63777458 |
| Molecular Formula | C11H7BrF2N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-bromo-1-[(2,4-difluorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)cc2F)cc1Br |
| InChI | InChI=1S/C11H7BrF2N2O2/c12-8-5-16(11(18)15-10(8)17)4-6-1-2-7(13)3-9(6)14/h1-3,5H,4H2,(H,15,17,18) |
| InChIKey | NAYWKGXJHUWCKQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |