C13H12BrFN2O2 — CID 66329734
1-[(5-bromo-2-fluorophenyl)methyl]-5-ethylpyrimidine-2,4-dione (PubChem CID 66329734) has the molecular formula C13H12BrFN2O2 and a molecular weight of 327.15 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66329734 |
| Molecular Formula | C13H12BrFN2O2 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1cn(Cc2cc(Br)ccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H12BrFN2O2/c1-2-8-6-17(13(19)16-12(8)18)7-9-5-10(14)3-4-11(9)15/h3-6H,2,7H2,1H3,(H,16,18,19) |
| InChIKey | MNBXUEPDRYXBKR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |